Products 1246308-80-4
CAS 1246308-80-4 appears in our catalog under these names: 4-(2-Nitrophenyl)dibenzo[b,d]furan, 97%, 4-(2-Nitrophenyl)dibenzo[b,d]furan, 97%, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(2-nitrophenyl)dibenzofuran (CAS 1246308-80-4) is a chemical compound with the molecular formula C18H11NO3 and a molecular weight of 289.3 g/mol. IUPAC name: 4-(2-nitrophenyl)dibenzofuran. InChIKey: ZPVONLLRBPTGCG-UHFFFAOYSA-N.
| Molecular formula | C18H11NO3 |
|---|---|
| Molecular weight | 289.3 g/mol |
| IUPAC name | 4-(2-nitrophenyl)dibenzofuran |
| InChIKey | ZPVONLLRBPTGCG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=CC3=C2OC4=CC=CC=C34)[N+](=O)[O-] |
Computed by PubChem (NCBI)