CAS 6914-99-4 appears in our catalog under these names: 2-(4-Hydroxy-phenyl)-benzo(de)isoquinoline-1,3-dione, 95%, 2-(4-Hydroxy-phenyl)-benzo(de)isoquinoline-1,3-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 0,5g, 50mg.
2-(4-hydroxyphenyl)benzo[de]isoquinoline-1,3-dione (CAS 6914-99-4) is a chemical compound with the molecular formula C18H11NO3 and a molecular weight of 289.3 g/mol. IUPAC name: 2-(4-hydroxyphenyl)benzo[de]isoquinoline-1,3-dione. InChIKey: MBOMACZFYPHXRJ-UHFFFAOYSA-N.
| Molecular formula | C18H11NO3 |
|---|---|
| Molecular weight | 289.3 g/mol |
| IUPAC name | 2-(4-hydroxyphenyl)benzo[de]isoquinoline-1,3-dione |
| InChIKey | MBOMACZFYPHXRJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C(=O)N(C(=O)C3=CC=C2)C4=CC=C(C=C4)O |
Computed by PubChem (NCBI)