CAS 881877-45-8 appears in our catalog under these names: 4-Hydroxy-5-phenyl-2-(phenylethynyl)-6h-1,3-oxazin-6-one, 95%, 4-Hydroxy-5-phenyl-2-(phenylethynyl)-6H-1,3-oxazin-6-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g.
4-hydroxy-5-phenyl-2-(2-phenylethynyl)-1,3-oxazin-6-one (CAS 881877-45-8) is a chemical compound with the molecular formula C18H11NO3 and a molecular weight of 289.3 g/mol. IUPAC name: 4-hydroxy-5-phenyl-2-(2-phenylethynyl)-1,3-oxazin-6-one. InChIKey: JQVFQHUHVDYTMM-UHFFFAOYSA-N.
| Molecular formula | C18H11NO3 |
|---|---|
| Molecular weight | 289.3 g/mol |
| IUPAC name | 4-hydroxy-5-phenyl-2-(2-phenylethynyl)-1,3-oxazin-6-one |
| InChIKey | JQVFQHUHVDYTMM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C#CC2=NC(=C(C(=O)O2)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)