CAS 1246308-82-6 appears in our catalog under these names: 2-(2-Nitrophenyl)dibenzo[b,d]furan, 95%, 2–(2–Nitrophenyl)dibenzo(b,d)furan. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g.
2-(2-nitrophenyl)dibenzofuran (CAS 1246308-82-6) is a chemical compound with the molecular formula C18H11NO3 and a molecular weight of 289.3 g/mol. IUPAC name: 2-(2-nitrophenyl)dibenzofuran. InChIKey: HNGVCNKOEXITNG-UHFFFAOYSA-N.
| Molecular formula | C18H11NO3 |
|---|---|
| Molecular weight | 289.3 g/mol |
| IUPAC name | 2-(2-nitrophenyl)dibenzofuran |
| InChIKey | HNGVCNKOEXITNG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC3=C(C=C2)OC4=CC=CC=C43)[N+](=O)[O-] |
Computed by PubChem (NCBI)