CAS 124650-29-9 appears in our catalog under these names: Octyl alpha-d-mannopyranoside, 97%, OCtyl alpha-d-mannopyranoside, 95%, Octyl α-D-mannopyranoside, (2R,3S,4S,5S,6S)-2-(Hydroxymethyl)-6-(octyloxy)tetrahydro-2H-pyran-3,4,5-triol, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 100mg, 500mg, 1000mg, 2000mg.
(2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-octoxyoxane-3,4,5-triol (CAS 124650-29-9) is a chemical compound with the molecular formula C14H28O6 and a molecular weight of 292.37 g/mol. IUPAC name: (2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-octoxyoxane-3,4,5-triol. InChIKey: HEGSGKPQLMEBJL-DGTMBMJNSA-N.
| Molecular formula | C14H28O6 |
|---|---|
| Molecular weight | 292.37 g/mol |
| IUPAC name | (2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-octoxyoxane-3,4,5-triol |
| InChIKey | HEGSGKPQLMEBJL-DGTMBMJNSA-N |
| SMILES | CCCCCCCCO[C@@H]1[C@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)