CAS 41444-50-2 appears in our catalog under these names: (2R,3S,4S,5R)-2-(Hydroxymethyl)-6-(octyloxy)tetrahydro-2H-pyran-3,4,5-triol, 98%, Octyl D-glucopyranoside, 95%. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
(2R,3S,4S,5R)-2-(hydroxymethyl)-6-octoxyoxane-3,4,5-triol (CAS 41444-50-2) is a chemical compound with the molecular formula C14H28O6 and a molecular weight of 292.37 g/mol. IUPAC name: (2R,3S,4S,5R)-2-(hydroxymethyl)-6-octoxyoxane-3,4,5-triol. InChIKey: HEGSGKPQLMEBJL-RQICVUQASA-N.
| Molecular formula | C14H28O6 |
|---|---|
| Molecular weight | 292.37 g/mol |
| IUPAC name | (2R,3S,4S,5R)-2-(hydroxymethyl)-6-octoxyoxane-3,4,5-triol |
| InChIKey | HEGSGKPQLMEBJL-RQICVUQASA-N |
| SMILES | CCCCCCCCOC1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)