CAS 140147-38-2 appears in our catalog under these names: Octyl beta-d-mannopyranoside, 95%, Octyl Beta-D-Mannopyranoside, >95% (HPLC), Octyl b-D-mannopyranoside, Octyl β-D-mannopyranoside. Offered by: Combi-blocks, TRC, Biosynth, MedChemExpress. Available pack sizes: 250mg, 100mg, 10mg, 1mg, 2,5mg, 25mg, 50mg, 1 mg.
(2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-octoxyoxane-3,4,5-triol (CAS 140147-38-2) is a chemical compound with the molecular formula C14H28O6 and a molecular weight of 292.37 g/mol. IUPAC name: (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-octoxyoxane-3,4,5-triol. InChIKey: HEGSGKPQLMEBJL-PEBLQZBPSA-N.
| Molecular formula | C14H28O6 |
|---|---|
| Molecular weight | 292.37 g/mol |
| IUPAC name | (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-octoxyoxane-3,4,5-triol |
| InChIKey | HEGSGKPQLMEBJL-PEBLQZBPSA-N |
| SMILES | CCCCCCCCO[C@H]1[C@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)