Products 125590-73-0
CAS 125590-73-0 is the registry number for 2-Ethylhexyl α-D-glucopyranoside, 60% in H2O, 60% in H2O. Offered by: Chemat. Available pack sizes: 500g, 2.5kg, 10kg.
(2S,3R,4S,5S,6R)-2-(2-ethylhexoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 125590-73-0) is a chemical compound with the molecular formula C14H28O6 and a molecular weight of 292.37 g/mol. IUPAC name: (2S,3R,4S,5S,6R)-2-(2-ethylhexoxy)-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: FYYKJKKBDPRFJO-IZVWSYFDSA-N.
| Molecular formula | C14H28O6 |
|---|---|
| Molecular weight | 292.37 g/mol |
| IUPAC name | (2S,3R,4S,5S,6R)-2-(2-ethylhexoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | FYYKJKKBDPRFJO-IZVWSYFDSA-N |
| SMILES | CCCCC(CC)CO[C@@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)