Products 1246522-54-2
CAS 1246522-54-2 is the registry number for 2-(Methoxymethyl)-5-(trifluoromethyl)benzoic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
2-(methoxymethyl)-5-(trifluoromethyl)benzoic acid (CAS 1246522-54-2) is a chemical compound with the molecular formula C10H9F3O3 and a molecular weight of 234.17 g/mol. IUPAC name: 2-(methoxymethyl)-5-(trifluoromethyl)benzoic acid. InChIKey: UYZBUTIXYQEZNF-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O3 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | 2-(methoxymethyl)-5-(trifluoromethyl)benzoic acid |
| InChIKey | UYZBUTIXYQEZNF-UHFFFAOYSA-N |
| SMILES | COCC1=C(C=C(C=C1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)