CAS 1246550-88-8 is the registry number for 3-(2,4-Difluorophenyl)piperazin-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(2,4-difluorophenyl)piperazin-2-one (CAS 1246550-88-8) is a chemical compound with the molecular formula C10H10F2N2O and a molecular weight of 212.20 g/mol. IUPAC name: 3-(2,4-difluorophenyl)piperazin-2-one. InChIKey: KLPOQBVNJFGBHO-UHFFFAOYSA-N.
| Molecular formula | C10H10F2N2O |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | 3-(2,4-difluorophenyl)piperazin-2-one |
| InChIKey | KLPOQBVNJFGBHO-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C(N1)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)