CAS 1499989-25-1 is the registry number for 2-(5,7-Difluoro-1H-benzo[d]imidazol-2-yl)propan-2-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4,6-difluoro-1H-benzimidazol-2-yl)propan-2-ol (CAS 1499989-25-1) is a chemical compound with the molecular formula C10H10F2N2O and a molecular weight of 212.20 g/mol. IUPAC name: 2-(4,6-difluoro-1H-benzimidazol-2-yl)propan-2-ol. InChIKey: VAGYFVLSLWBXKO-UHFFFAOYSA-N.
| Molecular formula | C10H10F2N2O |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | 2-(4,6-difluoro-1H-benzimidazol-2-yl)propan-2-ol |
| InChIKey | VAGYFVLSLWBXKO-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=NC2=C(N1)C=C(C=C2F)F)O |
Computed by PubChem (NCBI)