CAS 1523101-12-3 is the registry number for 1-(2-Amino-4,6-difluorophenyl)pyrrolidin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2-amino-4,6-difluorophenyl)pyrrolidin-2-one (CAS 1523101-12-3) is a chemical compound with the molecular formula C10H10F2N2O and a molecular weight of 212.20 g/mol. IUPAC name: 1-(2-amino-4,6-difluorophenyl)pyrrolidin-2-one. InChIKey: SPTGJVUOYOPDEX-UHFFFAOYSA-N.
| Molecular formula | C10H10F2N2O |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | 1-(2-amino-4,6-difluorophenyl)pyrrolidin-2-one |
| InChIKey | SPTGJVUOYOPDEX-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1)C2=C(C=C(C=C2F)F)N |
Computed by PubChem (NCBI)