CAS 1779131-89-3 is the registry number for 5-(3,3-Difluoropyrrolidin-1-yl)nicotinaldehyde, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(3,3-difluoropyrrolidin-1-yl)pyridine-3-carbaldehyde (CAS 1779131-89-3) is a chemical compound with the molecular formula C10H10F2N2O and a molecular weight of 212.20 g/mol. IUPAC name: 5-(3,3-difluoropyrrolidin-1-yl)pyridine-3-carbaldehyde. InChIKey: BIRZDYQZXWEIOG-UHFFFAOYSA-N.
| Molecular formula | C10H10F2N2O |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | 5-(3,3-difluoropyrrolidin-1-yl)pyridine-3-carbaldehyde |
| InChIKey | BIRZDYQZXWEIOG-UHFFFAOYSA-N |
| SMILES | C1CN(CC1(F)F)C2=CN=CC(=C2)C=O |
Computed by PubChem (NCBI)