Products 124658-44-2
CAS 124658-44-2 is the registry number for Ethyl (2E)-4-(4-methylphenyl)-4-oxo-2-butenoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Ethyl (E)-4-(4-methylphenyl)-4-oxobut-2-enoate (CAS 124658-44-2) is a chemical compound with the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. IUPAC name: ethyl (E)-4-(4-methylphenyl)-4-oxobut-2-enoate. InChIKey: MXBUYDGJUXPOBW-CMDGGOBGSA-N.
| Molecular formula | C13H14O3 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | ethyl (E)-4-(4-methylphenyl)-4-oxobut-2-enoate |
| InChIKey | MXBUYDGJUXPOBW-CMDGGOBGSA-N |
| SMILES | CCOC(=O)/C=C/C(=O)C1=CC=C(C=C1)C |
Computed by PubChem (NCBI)