CAS 2094288-79-4 is the registry number for 3-Oxa-6-azatricyclo(6.1.1.0,1,6)decane-4-carboxylic acid hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
3-oxa-6-azatricyclo[6.1.1.01,6]decane-4-carboxylic acid;hydrochloride (CAS 2094288-79-4) is a chemical compound with the molecular formula C9H14ClNO3 and a molecular weight of 219.66 g/mol. IUPAC name: 3-oxa-6-azatricyclo[6.1.1.01,6]decane-4-carboxylic acid;hydrochloride. InChIKey: YCCPNAMWKKIUNG-UHFFFAOYSA-N.
| Molecular formula | C9H14ClNO3 |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | 3-oxa-6-azatricyclo[6.1.1.01,6]decane-4-carboxylic acid;hydrochloride |
| InChIKey | YCCPNAMWKKIUNG-UHFFFAOYSA-N |
| SMILES | C1C2CC13COC(CN3C2)C(=O)O.Cl |
Computed by PubChem (NCBI)