Products 2094288-79-4

CAS 2094288-79-4 is the registry number for 3-Oxa-6-azatricyclo(6.1.1.0,1,6)decane-4-carboxylic acid hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.

3-oxa-6-azatricyclo[6.1.1.01,6]decane-4-carboxylic acid;hydrochloride (CAS 2094288-79-4) is a chemical compound with the molecular formula C9H14ClNO3 and a molecular weight of 219.66 g/mol. IUPAC name: 3-oxa-6-azatricyclo[6.1.1.01,6]decane-4-carboxylic acid;hydrochloride. InChIKey: YCCPNAMWKKIUNG-UHFFFAOYSA-N.

Identity
Molecular formulaC9H14ClNO3
Molecular weight219.66 g/mol
IUPAC name3-oxa-6-azatricyclo[6.1.1.01,6]decane-4-carboxylic acid;hydrochloride
InChIKeyYCCPNAMWKKIUNG-UHFFFAOYSA-N
SMILESC1C2CC13COC(CN3C2)C(=O)O.Cl

Computed by PubChem (NCBI)