CAS 1246776-77-1 appears in our catalog under these names: 3,4-Dichloro-2-methoxybenzenesulfonyl chloride, 95%, 3,4-Dichloro-2-methoxybenzene-1-sulfonyl chloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
3,4-dichloro-2-methoxybenzenesulfonyl chloride (CAS 1246776-77-1) is a chemical compound with the molecular formula C7H5Cl3O3S and a molecular weight of 275.5 g/mol. IUPAC name: 3,4-dichloro-2-methoxybenzenesulfonyl chloride. InChIKey: GLBKBJCCCSOVED-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl3O3S |
|---|---|
| Molecular weight | 275.5 g/mol |
| IUPAC name | 3,4-dichloro-2-methoxybenzenesulfonyl chloride |
| InChIKey | GLBKBJCCCSOVED-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1Cl)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)