CAS 35509-62-7 is the registry number for 2,5-Dichloro-4-methoxybenzene-1-sulfonyl chloride, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2,5-dichloro-4-methoxybenzenesulfonyl chloride (CAS 35509-62-7) is a chemical compound with the molecular formula C7H5Cl3O3S and a molecular weight of 275.5 g/mol. IUPAC name: 2,5-dichloro-4-methoxybenzenesulfonyl chloride. InChIKey: UXVBWWBVJVHLTI-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl3O3S |
|---|---|
| Molecular weight | 275.5 g/mol |
| IUPAC name | 2,5-dichloro-4-methoxybenzenesulfonyl chloride |
| InChIKey | UXVBWWBVJVHLTI-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1Cl)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)