Products 35509-62-7

CAS 35509-62-7 is the registry number for 2,5-Dichloro-4-methoxybenzene-1-sulfonyl chloride, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

2,5-dichloro-4-methoxybenzenesulfonyl chloride (CAS 35509-62-7) is a chemical compound with the molecular formula C7H5Cl3O3S and a molecular weight of 275.5 g/mol. IUPAC name: 2,5-dichloro-4-methoxybenzenesulfonyl chloride. InChIKey: UXVBWWBVJVHLTI-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5Cl3O3S
Molecular weight275.5 g/mol
IUPAC name2,5-dichloro-4-methoxybenzenesulfonyl chloride
InChIKeyUXVBWWBVJVHLTI-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1Cl)S(=O)(=O)Cl)Cl

Computed by PubChem (NCBI)