Products 35509-60-5

CAS 35509-60-5 is the registry number for 2,3-Dichloro-4-methoxybenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

2,3-dichloro-4-methoxybenzenesulfonyl chloride (CAS 35509-60-5) is a chemical compound with the molecular formula C7H5Cl3O3S and a molecular weight of 275.5 g/mol. IUPAC name: 2,3-dichloro-4-methoxybenzenesulfonyl chloride. InChIKey: AJHJBAMQCLTOGP-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5Cl3O3S
Molecular weight275.5 g/mol
IUPAC name2,3-dichloro-4-methoxybenzenesulfonyl chloride
InChIKeyAJHJBAMQCLTOGP-UHFFFAOYSA-N
SMILESCOC1=C(C(=C(C=C1)S(=O)(=O)Cl)Cl)Cl

Computed by PubChem (NCBI)