CAS 35509-60-5 is the registry number for 2,3-Dichloro-4-methoxybenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2,3-dichloro-4-methoxybenzenesulfonyl chloride (CAS 35509-60-5) is a chemical compound with the molecular formula C7H5Cl3O3S and a molecular weight of 275.5 g/mol. IUPAC name: 2,3-dichloro-4-methoxybenzenesulfonyl chloride. InChIKey: AJHJBAMQCLTOGP-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl3O3S |
|---|---|
| Molecular weight | 275.5 g/mol |
| IUPAC name | 2,3-dichloro-4-methoxybenzenesulfonyl chloride |
| InChIKey | AJHJBAMQCLTOGP-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)S(=O)(=O)Cl)Cl)Cl |
Computed by PubChem (NCBI)