Products 35517-53-4

CAS 35517-53-4 is the registry number for 3,5-Dichloro-4-methoxybenzenesulfonyl chloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

3,5-dichloro-4-methoxybenzenesulfonyl chloride (CAS 35517-53-4) is a chemical compound with the molecular formula C7H5Cl3O3S and a molecular weight of 275.5 g/mol. IUPAC name: 3,5-dichloro-4-methoxybenzenesulfonyl chloride. InChIKey: ASOJFVCQXARGQJ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5Cl3O3S
Molecular weight275.5 g/mol
IUPAC name3,5-dichloro-4-methoxybenzenesulfonyl chloride
InChIKeyASOJFVCQXARGQJ-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1Cl)S(=O)(=O)Cl)Cl

Computed by PubChem (NCBI)