Products 124681-15-8
CAS 124681-15-8 is the registry number for Salvinone. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(3-hydroxy-8,8-dimethyl-6,7-dihydro-5H-phenanthren-2-yl)ethanone (CAS 124681-15-8) is a chemical compound with the molecular formula C18H20O2 and a molecular weight of 268.3 g/mol. IUPAC name: 1-(3-hydroxy-8,8-dimethyl-6,7-dihydro-5H-phenanthren-2-yl)ethanone. InChIKey: ABHIZICAJIIGDO-UHFFFAOYSA-N.
| Molecular formula | C18H20O2 |
|---|---|
| Molecular weight | 268.3 g/mol |
| IUPAC name | 1-(3-hydroxy-8,8-dimethyl-6,7-dihydro-5H-phenanthren-2-yl)ethanone |
| InChIKey | ABHIZICAJIIGDO-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C2C3=C(C=CC2=C1)C(CCC3)(C)C)O |
Computed by PubChem (NCBI)