Products 1246814-66-3
CAS 1246814-66-3 appears in our catalog under these names: Tetrahydrozoline-d4 Hydrochloride, >95% (HPLC), Tetrahydrozoline–d4 hydrochloride, Tetrahydrozoline-d4 (hydrochloride), 99.80%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
4,4,5,5-tetradeuterio-2-(1,2,3,4-tetrahydronaphthalen-1-yl)-1H-imidazole;hydrochloride (CAS 1246814-66-3) is a chemical compound with the molecular formula C13H17ClN2 and a molecular weight of 240.76 g/mol. IUPAC name: 4,4,5,5-tetradeuterio-2-(1,2,3,4-tetrahydronaphthalen-1-yl)-1H-imidazole;hydrochloride. InChIKey: BJORNXNYWNIWEY-JRWKTVICSA-N.
| Molecular formula | C13H17ClN2 |
|---|---|
| Molecular weight | 240.76 g/mol |
| IUPAC name | 4,4,5,5-tetradeuterio-2-(1,2,3,4-tetrahydronaphthalen-1-yl)-1H-imidazole;hydrochloride |
| InChIKey | BJORNXNYWNIWEY-JRWKTVICSA-N |
| SMILES | [2H]C1(C(N=C(N1)C2CCCC3=CC=CC=C23)([2H])[2H])[2H].Cl |
Computed by PubChem (NCBI)