Products 1246814-79-8
CAS 1246814-79-8 appears in our catalog under these names: Mosapride Impurity 5-d5 (Des-4-fluorobenzyl Mosapride-d5), Des-4-fluorobenzyl Mosapride-d5, Des-p-fluorobenzyl mosapride-d5. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 25mg, 10 mg, 1 mg.
4-amino-5-chloro-N-(morpholin-2-ylmethyl)-2-(1,1,2,2,2-pentadeuterioethoxy)benzamide (CAS 1246814-79-8) is a chemical compound with the molecular formula C14H20ClN3O3 and a molecular weight of 318.81 g/mol. IUPAC name: 4-amino-5-chloro-N-(morpholin-2-ylmethyl)-2-(1,1,2,2,2-pentadeuterioethoxy)benzamide. InChIKey: HQOQHUQAQLNFOP-ZBJDZAJPSA-N.
| Molecular formula | C14H20ClN3O3 |
|---|---|
| Molecular weight | 318.81 g/mol |
| IUPAC name | 4-amino-5-chloro-N-(morpholin-2-ylmethyl)-2-(1,1,2,2,2-pentadeuterioethoxy)benzamide |
| InChIKey | HQOQHUQAQLNFOP-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC1=CC(=C(C=C1C(=O)NCC2CNCCO2)Cl)N |
Computed by PubChem (NCBI)