Products 145118-98-5
CAS 145118-98-5 is the registry number for beta-Casomorphin (1-2) amide. Offered by: Biosynth. Available pack sizes: 500mg, 250mg, 1000mg.
(2S)-1-[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carboxamide;hydrochloride (CAS 145118-98-5) is a chemical compound with the molecular formula C14H20ClN3O3 and a molecular weight of 313.78 g/mol. IUPAC name: (2S)-1-[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carboxamide;hydrochloride. InChIKey: QPVQJGGILVHAIW-FXMYHANSSA-N.
| Molecular formula | C14H20ClN3O3 |
|---|---|
| Molecular weight | 313.78 g/mol |
| IUPAC name | (2S)-1-[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carboxamide;hydrochloride |
| InChIKey | QPVQJGGILVHAIW-FXMYHANSSA-N |
| SMILES | C1C[C@H](N(C1)C(=O)[C@H](CC2=CC=C(C=C2)O)N)C(=O)N.Cl |
Computed by PubChem (NCBI)