Products 289893-23-8
CAS 289893-23-8 appears in our catalog under these names: Anti–neurodegeneration agent 1, Anti-neurodegeneration agent 1. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 20mg, 5mg, Get quote.
(3Z)-N-(2-hydroxy-3-piperidin-1-ylpropoxy)-1-oxidopyridin-1-ium-3-carboximidoyl chloride (CAS 289893-23-8) is a chemical compound with the molecular formula C14H20ClN3O3 and a molecular weight of 313.78 g/mol. IUPAC name: (3Z)-N-(2-hydroxy-3-piperidin-1-ylpropoxy)-1-oxidopyridin-1-ium-3-carboximidoyl chloride. InChIKey: SGEIEGAXKLMUIZ-PEZBUJJGSA-N.
| Molecular formula | C14H20ClN3O3 |
|---|---|
| Molecular weight | 313.78 g/mol |
| IUPAC name | (3Z)-N-(2-hydroxy-3-piperidin-1-ylpropoxy)-1-oxidopyridin-1-ium-3-carboximidoyl chloride |
| InChIKey | SGEIEGAXKLMUIZ-PEZBUJJGSA-N |
| SMILES | C1CCN(CC1)CC(CO/N=C(/C2=C[N+](=CC=C2)[O-])\Cl)O |
Computed by PubChem (NCBI)
Synonyms:
Anti-neurodegeneration agent 1