CAS 152013-26-8 appears in our catalog under these names: Mosapride Impurity 5 (Des-4-Fluorobenzyl Mosapride), Mosapride Impurity 2, 4-Amino-5-chloro-2-ethoxy-N-(morpholin-2-ylmethyl)benzamide, 97%, Des-4-fluorobenzyl Mosapride, Des–4–fluorobenzyl Mosapride. Offered by: Chemat Brand, Hubei YoungXin, TRC, GLPBio, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 2,5mg.
4-amino-5-chloro-2-ethoxy-N-(morpholin-2-ylmethyl)benzamide (CAS 152013-26-8) is a chemical compound with the molecular formula C14H20ClN3O3 and a molecular weight of 313.78 g/mol. IUPAC name: 4-amino-5-chloro-2-ethoxy-N-(morpholin-2-ylmethyl)benzamide. InChIKey: HQOQHUQAQLNFOP-UHFFFAOYSA-N.
| Molecular formula | C14H20ClN3O3 |
|---|---|
| Molecular weight | 313.78 g/mol |
| IUPAC name | 4-amino-5-chloro-2-ethoxy-N-(morpholin-2-ylmethyl)benzamide |
| InChIKey | HQOQHUQAQLNFOP-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C=C1C(=O)NCC2CNCCO2)Cl)N |
Computed by PubChem (NCBI)