Products 1246814-82-3
CAS 1246814-82-3 is the registry number for Cyclizine-d4 Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 50mg, 5mg.
1-benzhydryl-2,2,6,6-tetradeuterio-4-methylpiperazine;hydrochloride (CAS 1246814-82-3) is a chemical compound with the molecular formula C18H23ClN2 and a molecular weight of 306.9 g/mol. IUPAC name: 1-benzhydryl-2,2,6,6-tetradeuterio-4-methylpiperazine;hydrochloride. InChIKey: UKPBEPCQTDRZSE-AKJKYJKUSA-N.
| Molecular formula | C18H23ClN2 |
|---|---|
| Molecular weight | 306.9 g/mol |
| IUPAC name | 1-benzhydryl-2,2,6,6-tetradeuterio-4-methylpiperazine;hydrochloride |
| InChIKey | UKPBEPCQTDRZSE-AKJKYJKUSA-N |
| SMILES | [2H]C1(CN(CC(N1C(C2=CC=CC=C2)C3=CC=CC=C3)([2H])[2H])C)[2H].Cl |
Computed by PubChem (NCBI)