Products 1435934-62-5
CAS 1435934-62-5 is the registry number for Desipramine-D3 Hydrochloride 0.1 mg/ml in Methanol (as free base). Offered by: LoGiCal. Available pack sizes: 1ml.
3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-(trideuteriomethyl)propan-1-amine;hydrochloride (CAS 1435934-62-5) is a chemical compound with the molecular formula C18H23ClN2 and a molecular weight of 305.9 g/mol. IUPAC name: 3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-(trideuteriomethyl)propan-1-amine;hydrochloride. InChIKey: XAEWZDYWZHIUCT-NIIDSAIPSA-N.
| Molecular formula | C18H23ClN2 |
|---|---|
| Molecular weight | 305.9 g/mol |
| IUPAC name | 3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-(trideuteriomethyl)propan-1-amine;hydrochloride |
| InChIKey | XAEWZDYWZHIUCT-NIIDSAIPSA-N |
| SMILES | [2H]C([2H])([2H])NCCCN1C2=CC=CC=C2CCC3=CC=CC=C31.Cl |
Computed by PubChem (NCBI)