Products 61361-34-0
CAS 61361-34-0 appears in our catalog under these names: Desipramine-d4 HCl, Desipramine Hydrochloride-d4, Desipramine-2,4,6,8-d4 Hydrochloride, >95% (HPLC), Desipramine-2,4,6,8-d4 HCl, 98 atom % D, min 98% Chemical Purity, Desipramine–d4 (hydrochloride). Offered by: Chemat Brand, Hubei YoungXin, TRC, CDN, GLPBio. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 0,01g.
N-methyl-3-(1,3,8,10-tetradeuterio-5,6-dihydrobenzo[b][1]benzazepin-11-yl)propan-1-amine;hydrochloride (CAS 61361-34-0) is a chemical compound with the molecular formula C18H23ClN2 and a molecular weight of 306.9 g/mol. IUPAC name: N-methyl-3-(1,3,8,10-tetradeuterio-5,6-dihydrobenzo[b][1]benzazepin-11-yl)propan-1-amine;hydrochloride. InChIKey: XAEWZDYWZHIUCT-TUJKZWLVSA-N.
| Molecular formula | C18H23ClN2 |
|---|---|
| Molecular weight | 306.9 g/mol |
| IUPAC name | N-methyl-3-(1,3,8,10-tetradeuterio-5,6-dihydrobenzo[b][1]benzazepin-11-yl)propan-1-amine;hydrochloride |
| InChIKey | XAEWZDYWZHIUCT-TUJKZWLVSA-N |
| SMILES | [2H]C1=CC(=C2C(=C1)CCC3=CC(=CC(=C3N2CCCNC)[2H])[2H])[2H].Cl |
Computed by PubChem (NCBI)