Products 1391062-43-3
CAS 1391062-43-3 appears in our catalog under these names: N,N’-Bis(2,4-xylyl)-N-methylformamidine Hydrochloride, N,N-Bis(2,4-xylyl)-N-methylformamidine hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 25mg.
N,N'-bis(2,4-dimethylphenyl)-N-methylmethanimidamide;hydrochloride (CAS 1391062-43-3) is a chemical compound with the molecular formula C18H23ClN2 and a molecular weight of 302.8 g/mol. IUPAC name: N,N'-bis(2,4-dimethylphenyl)-N-methylmethanimidamide;hydrochloride. InChIKey: NUHCFFJDKBLRIZ-UHFFFAOYSA-N.
| Molecular formula | C18H23ClN2 |
|---|---|
| Molecular weight | 302.8 g/mol |
| IUPAC name | N,N'-bis(2,4-dimethylphenyl)-N-methylmethanimidamide;hydrochloride |
| InChIKey | NUHCFFJDKBLRIZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N=CN(C)C2=C(C=C(C=C2)C)C)C.Cl |
Computed by PubChem (NCBI)