CAS 1246815-67-7 appears in our catalog under these names: Diethyl 2-Methyl-d3-2-propylmalonate, Diethyl 2-(methyl-d3)-2-propylmalonate. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 10 mg, 100 mg.
Diethyl 2-propyl-2-(trideuteriomethyl)propanedioate (CAS 1246815-67-7) is a chemical compound with the molecular formula C11H20O4 and a molecular weight of 219.29 g/mol. IUPAC name: diethyl 2-propyl-2-(trideuteriomethyl)propanedioate. InChIKey: DTHLCPJSRSNVLX-GKOSEXJESA-N.
| Molecular formula | C11H20O4 |
|---|---|
| Molecular weight | 219.29 g/mol |
| IUPAC name | diethyl 2-propyl-2-(trideuteriomethyl)propanedioate |
| InChIKey | DTHLCPJSRSNVLX-GKOSEXJESA-N |
| SMILES | [2H]C([2H])([2H])C(CCC)(C(=O)OCC)C(=O)OCC |
Computed by PubChem (NCBI)