CAS 1246815-70-2 appears in our catalog under these names: Terbutaline EP Impurity C HCl (Terbutalone HCl), Terbutaline Impurity 3（Terbutaline EP Impurity C）, 1-(3,5-Dihydroxyphenyl)-2-((1,1-dimethylethyl)amino)-ethanone Hydrochloride, >95% (HPLC), Terbutaline impurity C, 1-(3,5-Dihydroxyphenyl)-2-((1,1-dimethylethyl)amino)-ethanone hydrochloride. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
2-(tert-butylamino)-1-(3,5-dihydroxyphenyl)ethanone;hydrochloride (CAS 1246815-70-2) is a chemical compound with the molecular formula C12H18ClNO3 and a molecular weight of 259.73 g/mol. IUPAC name: 2-(tert-butylamino)-1-(3,5-dihydroxyphenyl)ethanone;hydrochloride. InChIKey: FGGRGJLIOYGPRD-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO3 |
|---|---|
| Molecular weight | 259.73 g/mol |
| IUPAC name | 2-(tert-butylamino)-1-(3,5-dihydroxyphenyl)ethanone;hydrochloride |
| InChIKey | FGGRGJLIOYGPRD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(=O)C1=CC(=CC(=C1)O)O.Cl |
Computed by PubChem (NCBI)