CAS 257288-46-3 appears in our catalog under these names: N-Me-Thr(Bzl)-OH · HCl, N-Me-Thr(Bzl)-OH·HCl. Offered by: Creative Peptides, Biosynth. Available pack sizes: 1g, 5g, 2000mg, 5000mg, 10000mg.
(2S,3R)-2-(methylamino)-3-phenylmethoxybutanoic acid;hydrochloride (CAS 257288-46-3) is a chemical compound with the molecular formula C12H18ClNO3 and a molecular weight of 259.73 g/mol. IUPAC name: (2S,3R)-2-(methylamino)-3-phenylmethoxybutanoic acid;hydrochloride. InChIKey: SQBOHJZPWMUBLI-XQKZEKTMSA-N.
| Molecular formula | C12H18ClNO3 |
|---|---|
| Molecular weight | 259.73 g/mol |
| IUPAC name | (2S,3R)-2-(methylamino)-3-phenylmethoxybutanoic acid;hydrochloride |
| InChIKey | SQBOHJZPWMUBLI-XQKZEKTMSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)NC)OCC1=CC=CC=C1.Cl |
Computed by PubChem (NCBI)