Products 383677-77-8

CAS 383677-77-8 is the registry number for Methyl 2-[4-(3-aminopropoxy)phenyl]acetate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Methyl 2-[4-(3-aminopropoxy)phenyl]acetate;hydrochloride (CAS 383677-77-8) is a chemical compound with the molecular formula C12H18ClNO3 and a molecular weight of 259.73 g/mol. IUPAC name: methyl 2-[4-(3-aminopropoxy)phenyl]acetate;hydrochloride. InChIKey: XLHSHXQJZPWBSI-UHFFFAOYSA-N.

Identity
Molecular formulaC12H18ClNO3
Molecular weight259.73 g/mol
IUPAC namemethyl 2-[4-(3-aminopropoxy)phenyl]acetate;hydrochloride
InChIKeyXLHSHXQJZPWBSI-UHFFFAOYSA-N
SMILESCOC(=O)CC1=CC=C(C=C1)OCCCN.Cl

Computed by PubChem (NCBI)