Products 610319-10-3

CAS 610319-10-3 is the registry number for Methyl 2-[3-(3-aminopropoxy)phenyl]acetate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Methyl 2-[3-(3-aminopropoxy)phenyl]acetate;hydrochloride (CAS 610319-10-3) is a chemical compound with the molecular formula C12H18ClNO3 and a molecular weight of 259.73 g/mol. IUPAC name: methyl 2-[3-(3-aminopropoxy)phenyl]acetate;hydrochloride. InChIKey: OENCQXBKAJNQIY-UHFFFAOYSA-N.

Identity
Molecular formulaC12H18ClNO3
Molecular weight259.73 g/mol
IUPAC namemethyl 2-[3-(3-aminopropoxy)phenyl]acetate;hydrochloride
InChIKeyOENCQXBKAJNQIY-UHFFFAOYSA-N
SMILESCOC(=O)CC1=CC(=CC=C1)OCCCN.Cl

Computed by PubChem (NCBI)