Products 1246816-08-9
CAS 1246816-08-9 appears in our catalog under these names: 1-Hydroxy Tacrine-d4 HCl, Velnacrine–d4 hydrochloride, Velnacrine-d4 (hydrochloride), 98.60%. Offered by: Chemat Brand, GLPBio, MedChemExpress. Available pack sizes: on request, 1mg, 1 mg.
9-amino-5,6,7,8-tetradeuterio-1,2,3,4-tetrahydroacridin-1-ol;hydrochloride (CAS 1246816-08-9) is a chemical compound with the molecular formula C13H15ClN2O and a molecular weight of 254.75 g/mol. IUPAC name: 9-amino-5,6,7,8-tetradeuterio-1,2,3,4-tetrahydroacridin-1-ol;hydrochloride. InChIKey: IJWCYOSTVLKCCX-XLJCJYTQSA-N.
| Molecular formula | C13H15ClN2O |
|---|---|
| Molecular weight | 254.75 g/mol |
| IUPAC name | 9-amino-5,6,7,8-tetradeuterio-1,2,3,4-tetrahydroacridin-1-ol;hydrochloride |
| InChIKey | IJWCYOSTVLKCCX-XLJCJYTQSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C3C(CCCC3=N2)O)N)[2H])[2H].Cl |
Computed by PubChem (NCBI)