CAS 1246816-23-8 is the registry number for 5–Acetylamino–6–amino–3–methyluracil–d3 Hydrate. Offered by: GLPBio. Available pack sizes: 50mg.
N-[6-amino-2,4-dioxo-3-(trideuteriomethyl)-1H-pyrimidin-5-yl]acetamide;hydrate (CAS 1246816-23-8) is a chemical compound with the molecular formula C7H12N4O4 and a molecular weight of 219.21 g/mol. IUPAC name: N-[6-amino-2,4-dioxo-3-(trideuteriomethyl)-1H-pyrimidin-5-yl]acetamide;hydrate. InChIKey: UISWGTUSVPTGHL-MUTAZJQDSA-N.
| Molecular formula | C7H12N4O4 |
|---|---|
| Molecular weight | 219.21 g/mol |
| IUPAC name | N-[6-amino-2,4-dioxo-3-(trideuteriomethyl)-1H-pyrimidin-5-yl]acetamide;hydrate |
| InChIKey | UISWGTUSVPTGHL-MUTAZJQDSA-N |
| SMILES | [2H]C([2H])([2H])N1C(=O)C(=C(NC1=O)N)NC(=O)C.O |
Computed by PubChem (NCBI)