Products 1989659-34-8

CAS 1989659-34-8 is the registry number for 5-(2-Aminoethyl)-1H-imidazol-2-amine oxalate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

5-(2-aminoethyl)-1H-imidazol-2-amine;oxalic acid (CAS 1989659-34-8) is a chemical compound with the molecular formula C7H12N4O4 and a molecular weight of 216.19 g/mol. IUPAC name: 5-(2-aminoethyl)-1H-imidazol-2-amine;oxalic acid. InChIKey: NRXWTKCTLKUKCV-UHFFFAOYSA-N.

Identity
Molecular formulaC7H12N4O4
Molecular weight216.19 g/mol
IUPAC name5-(2-aminoethyl)-1H-imidazol-2-amine;oxalic acid
InChIKeyNRXWTKCTLKUKCV-UHFFFAOYSA-N
SMILESC1=C(NC(=N1)N)CCN.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)