CAS 1989659-34-8 is the registry number for 5-(2-Aminoethyl)-1H-imidazol-2-amine oxalate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(2-aminoethyl)-1H-imidazol-2-amine;oxalic acid (CAS 1989659-34-8) is a chemical compound with the molecular formula C7H12N4O4 and a molecular weight of 216.19 g/mol. IUPAC name: 5-(2-aminoethyl)-1H-imidazol-2-amine;oxalic acid. InChIKey: NRXWTKCTLKUKCV-UHFFFAOYSA-N.
| Molecular formula | C7H12N4O4 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | 5-(2-aminoethyl)-1H-imidazol-2-amine;oxalic acid |
| InChIKey | NRXWTKCTLKUKCV-UHFFFAOYSA-N |
| SMILES | C1=C(NC(=N1)N)CCN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)