CAS 1246816-64-7 appears in our catalog under these names: Pentoxifylline Acid-d6, 1-(3-Carboxypropyl)-3,7-dimethyl Xanthine-d6, 1-(3-Carboxypropyl)-3,7-dimethylxanthine-d6. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 25mg, 10 mg, 1 mg.
4-[2,6-dioxo-3,7-bis(trideuteriomethyl)purin-1-yl]butanoic acid (CAS 1246816-64-7) is a chemical compound with the molecular formula C11H14N4O4 and a molecular weight of 272.29 g/mol. IUPAC name: 4-[2,6-dioxo-3,7-bis(trideuteriomethyl)purin-1-yl]butanoic acid. InChIKey: WKASGTGXOGALBG-WFGJKAKNSA-N.
| Molecular formula | C11H14N4O4 |
|---|---|
| Molecular weight | 272.29 g/mol |
| IUPAC name | 4-[2,6-dioxo-3,7-bis(trideuteriomethyl)purin-1-yl]butanoic acid |
| InChIKey | WKASGTGXOGALBG-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])N1C=NC2=C1C(=O)N(C(=O)N2C([2H])([2H])[2H])CCCC(=O)O |
Computed by PubChem (NCBI)