CAS 1246817-86-6 appears in our catalog under these names: Cyclopropyl Pemoline-d5, Cyclazodone-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 25mg, 10 mg, 1 mg.
2-cyclopropylimino-5-(2,3,4,5,6-pentadeuteriophenyl)-1,3-oxazolidin-4-one (CAS 1246817-86-6) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 221.27 g/mol. IUPAC name: 2-cyclopropylimino-5-(2,3,4,5,6-pentadeuteriophenyl)-1,3-oxazolidin-4-one. InChIKey: DNRKTAYPGADPGW-RALIUCGRSA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 221.27 g/mol |
| IUPAC name | 2-cyclopropylimino-5-(2,3,4,5,6-pentadeuteriophenyl)-1,3-oxazolidin-4-one |
| InChIKey | DNRKTAYPGADPGW-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2C(=O)NC(=NC3CC3)O2)[2H])[2H] |
Computed by PubChem (NCBI)