CAS 14461-91-7 appears in our catalog under these names: Cyclopropyl Pemoline, Cyclazodone. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 100mg, 10mg, 1mg, 5mg, 25mg, 50mg, 5 mg, 1 mg.
2-cyclopropylimino-5-phenyl-1,3-oxazolidin-4-one (CAS 14461-91-7) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: 2-cyclopropylimino-5-phenyl-1,3-oxazolidin-4-one. InChIKey: DNRKTAYPGADPGW-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | 2-cyclopropylimino-5-phenyl-1,3-oxazolidin-4-one |
| InChIKey | DNRKTAYPGADPGW-UHFFFAOYSA-N |
| SMILES | C1CC1N=C2NC(=O)C(O2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)