Products 1246818-19-8

CAS 1246818-19-8 is the registry number for Ethyl 2-(6-Nitro-2,3-dichlorobenzyl)glycine-13C2. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2.5 mg, 25 mg.

Structural formula: {0} (CAS {1})

Ethyl 2-[(2,3-dichloro-6-nitrophenyl)methylamino]acetate (CAS 1246818-19-8) is a chemical compound with the molecular formula C11H12Cl2N2O4 and a molecular weight of 309.11 g/mol. IUPAC name: ethyl 2-[(2,3-dichloro-6-nitrophenyl)methylamino]acetate. InChIKey: NSGVBEKJYQRLIP-UFYQYTSASA-N.

Identity
Molecular formulaC11H12Cl2N2O4
Molecular weight309.11 g/mol
IUPAC nameethyl 2-[(2,3-dichloro-6-nitrophenyl)methylamino]acetate
InChIKeyNSGVBEKJYQRLIP-UFYQYTSASA-N
SMILESCCO[13C](=O)[13CH2]NCC1=C(C=CC(=C1Cl)Cl)[N+](=O)[O-]

Computed by PubChem (NCBI)