CAS 1246818-19-8 is the registry number for Ethyl 2-(6-Nitro-2,3-dichlorobenzyl)glycine-13C2. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2.5 mg, 25 mg.
Ethyl 2-[(2,3-dichloro-6-nitrophenyl)methylamino]acetate (CAS 1246818-19-8) is a chemical compound with the molecular formula C11H12Cl2N2O4 and a molecular weight of 309.11 g/mol. IUPAC name: ethyl 2-[(2,3-dichloro-6-nitrophenyl)methylamino]acetate. InChIKey: NSGVBEKJYQRLIP-UFYQYTSASA-N.
| Molecular formula | C11H12Cl2N2O4 |
|---|---|
| Molecular weight | 309.11 g/mol |
| IUPAC name | ethyl 2-[(2,3-dichloro-6-nitrophenyl)methylamino]acetate |
| InChIKey | NSGVBEKJYQRLIP-UFYQYTSASA-N |
| SMILES | CCO[13C](=O)[13CH2]NCC1=C(C=CC(=C1Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)