CAS 67058-47-3 is the registry number for Nitrosochloramphenicol. Offered by: TRC. Available pack sizes: 500mg.
2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrosophenyl)propan-2-yl]acetamide (CAS 67058-47-3) is a chemical compound with the molecular formula C11H12Cl2N2O4 and a molecular weight of 307.13 g/mol. IUPAC name: 2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrosophenyl)propan-2-yl]acetamide. InChIKey: YEYNNMGBNJOTRQ-RKDXNWHRSA-N.
| Molecular formula | C11H12Cl2N2O4 |
|---|---|
| Molecular weight | 307.13 g/mol |
| IUPAC name | 2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrosophenyl)propan-2-yl]acetamide |
| InChIKey | YEYNNMGBNJOTRQ-RKDXNWHRSA-N |
| SMILES | C1=CC(=CC=C1[C@H]([C@@H](CO)NC(=O)C(Cl)Cl)O)N=O |
Computed by PubChem (NCBI)