CAS 85325-11-7 is the registry number for Ethyl 2-(6-Nitro-2,3-dichlorobenzyl)glycine. Offered by: TRC. Available pack sizes: 1g, 250mg, 500mg.
Ethyl 2-[(2,3-dichloro-6-nitrophenyl)methylamino]acetate (CAS 85325-11-7) is a chemical compound with the molecular formula C11H12Cl2N2O4 and a molecular weight of 307.13 g/mol. IUPAC name: ethyl 2-[(2,3-dichloro-6-nitrophenyl)methylamino]acetate. InChIKey: NSGVBEKJYQRLIP-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2N2O4 |
|---|---|
| Molecular weight | 307.13 g/mol |
| IUPAC name | ethyl 2-[(2,3-dichloro-6-nitrophenyl)methylamino]acetate |
| InChIKey | NSGVBEKJYQRLIP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CNCC1=C(C=CC(=C1Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)