Products 85325-11-7

CAS 85325-11-7 is the registry number for Ethyl 2-(6-Nitro-2,3-dichlorobenzyl)glycine. Offered by: TRC. Available pack sizes: 1g, 250mg, 500mg.

Structural formula: {0} (CAS {1})

Ethyl 2-[(2,3-dichloro-6-nitrophenyl)methylamino]acetate (CAS 85325-11-7) is a chemical compound with the molecular formula C11H12Cl2N2O4 and a molecular weight of 307.13 g/mol. IUPAC name: ethyl 2-[(2,3-dichloro-6-nitrophenyl)methylamino]acetate. InChIKey: NSGVBEKJYQRLIP-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12Cl2N2O4
Molecular weight307.13 g/mol
IUPAC nameethyl 2-[(2,3-dichloro-6-nitrophenyl)methylamino]acetate
InChIKeyNSGVBEKJYQRLIP-UHFFFAOYSA-N
SMILESCCOC(=O)CNCC1=C(C=CC(=C1Cl)Cl)[N+](=O)[O-]

Computed by PubChem (NCBI)