Products 2287298-89-7
CAS 2287298-89-7 is the registry number for 4-((tert-Butoxycarbonyl)amino)-3,6-dichloropicolinic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3,6-dichloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-2-carboxylic acid (CAS 2287298-89-7) is a chemical compound with the molecular formula C11H12Cl2N2O4 and a molecular weight of 307.13 g/mol. IUPAC name: 3,6-dichloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-2-carboxylic acid. InChIKey: FNWZWEVTTIVFLL-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2N2O4 |
|---|---|
| Molecular weight | 307.13 g/mol |
| IUPAC name | 3,6-dichloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-2-carboxylic acid |
| InChIKey | FNWZWEVTTIVFLL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=NC(=C1Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)