Products 1246819-33-9
CAS 1246819-33-9 appears in our catalog under these names: Promazine-d6 HCl, Promazine-d6 Hydrochloride, >95% (HPLC), Promazine-d6 (hydrochloride), D6-Promazine hydrochloride. Offered by: Chemat Brand, TRC, MedChemExpress, HPC Standards. Available pack sizes: on request, 10mg, 1mg, 10 mg, 1 mg, 1x10mg.
3-phenothiazin-10-yl-N,N-bis(trideuteriomethyl)propan-1-amine;hydrochloride (CAS 1246819-33-9) is a chemical compound with the molecular formula C17H21ClN2S and a molecular weight of 326.9 g/mol. IUPAC name: 3-phenothiazin-10-yl-N,N-bis(trideuteriomethyl)propan-1-amine;hydrochloride. InChIKey: JIVSXRLRGOICGA-TXHXQZCNSA-N.
| Molecular formula | C17H21ClN2S |
|---|---|
| Molecular weight | 326.9 g/mol |
| IUPAC name | 3-phenothiazin-10-yl-N,N-bis(trideuteriomethyl)propan-1-amine;hydrochloride |
| InChIKey | JIVSXRLRGOICGA-TXHXQZCNSA-N |
| SMILES | [2H]C([2H])([2H])N(CCCN1C2=CC=CC=C2SC3=CC=CC=C31)C([2H])([2H])[2H].Cl |
Computed by PubChem (NCBI)