CAS 1329835-09-7 appears in our catalog under these names: Iso Promethazine-d3 Hydrochloride, >95% (HPLC), Iso promethazine-d3 hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 25mg, 5mg, 1mg, 50mg.
N-methyl-2-phenothiazin-10-yl-N-(trideuteriomethyl)propan-1-amine;hydrochloride (CAS 1329835-09-7) is a chemical compound with the molecular formula C17H21ClN2S and a molecular weight of 323.9 g/mol. IUPAC name: N-methyl-2-phenothiazin-10-yl-N-(trideuteriomethyl)propan-1-amine;hydrochloride. InChIKey: RISCHQYUHLQSBU-MUTAZJQDSA-N.
| Molecular formula | C17H21ClN2S |
|---|---|
| Molecular weight | 323.9 g/mol |
| IUPAC name | N-methyl-2-phenothiazin-10-yl-N-(trideuteriomethyl)propan-1-amine;hydrochloride |
| InChIKey | RISCHQYUHLQSBU-MUTAZJQDSA-N |
| SMILES | [2H]C([2H])([2H])N(C)CC(C)N1C2=CC=CC=C2SC3=CC=CC=C31.Cl |
Computed by PubChem (NCBI)