Products 1189947-02-1
CAS 1189947-02-1 appears in our catalog under these names: Promethazine–d6 hydrochloride, Promethazine-d6, Promethazine-d6 Hydrochloride, >95% (HPLC), Promethazine-d6 (hydrochloride), D6-Promethazine hydrochloride. Offered by: GLPBio, Chemat Brand, TRC, MedChemExpress, HPC Standards. Available pack sizes: 1mg, on request, 10mg, 5mg, 1 mg, 1x10mg.
1-phenothiazin-10-yl-N,N-bis(trideuteriomethyl)propan-2-amine;hydrochloride (CAS 1189947-02-1) is a chemical compound with the molecular formula C17H21ClN2S and a molecular weight of 326.9 g/mol. IUPAC name: 1-phenothiazin-10-yl-N,N-bis(trideuteriomethyl)propan-2-amine;hydrochloride. InChIKey: XXPDBLUZJRXNNZ-HVTBMTIBSA-N.
| Molecular formula | C17H21ClN2S |
|---|---|
| Molecular weight | 326.9 g/mol |
| IUPAC name | 1-phenothiazin-10-yl-N,N-bis(trideuteriomethyl)propan-2-amine;hydrochloride |
| InChIKey | XXPDBLUZJRXNNZ-HVTBMTIBSA-N |
| SMILES | [2H]C([2H])([2H])N(C(C)CN1C2=CC=CC=C2SC3=CC=CC=C31)C([2H])([2H])[2H].Cl |
Computed by PubChem (NCBI)