CAS 5568-90-1 appears in our catalog under these names: Promethazine EP Impurity B HCl (Isopromethazine HCl), Promethazine EP Impurity B HCl, Promethazine Impurity 2(EP Impurity B), Iso Promethazine Hydrochloride, >95% (HPLC), Isopromethazine Hydrochloride, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1g, 250mg.
N,N-dimethyl-2-phenothiazin-10-ylpropan-1-amine;hydrochloride (CAS 5568-90-1) is a chemical compound with the molecular formula C17H21ClN2S and a molecular weight of 320.9 g/mol. IUPAC name: N,N-dimethyl-2-phenothiazin-10-ylpropan-1-amine;hydrochloride. InChIKey: RISCHQYUHLQSBU-UHFFFAOYSA-N.
| Molecular formula | C17H21ClN2S |
|---|---|
| Molecular weight | 320.9 g/mol |
| IUPAC name | N,N-dimethyl-2-phenothiazin-10-ylpropan-1-amine;hydrochloride |
| InChIKey | RISCHQYUHLQSBU-UHFFFAOYSA-N |
| SMILES | CC(CN(C)C)N1C2=CC=CC=C2SC3=CC=CC=C31.Cl |
Computed by PubChem (NCBI)