Products 1246819-56-6
CAS 1246819-56-6 appears in our catalog under these names: 6-Amino-5-nitroso-3-methyluracil-d3, 6–Amino–5–nitroso–3–methyluracil–d3. Offered by: TRC, GLPBio. Available pack sizes: 50mg, 5mg.
6-amino-5-nitroso-3-(trideuteriomethyl)-1H-pyrimidine-2,4-dione (CAS 1246819-56-6) is a chemical compound with the molecular formula C5H6N4O3 and a molecular weight of 173.14 g/mol. IUPAC name: 6-amino-5-nitroso-3-(trideuteriomethyl)-1H-pyrimidine-2,4-dione. InChIKey: GUDXLMQIDACJSU-FIBGUPNXSA-N.
| Molecular formula | C5H6N4O3 |
|---|---|
| Molecular weight | 173.14 g/mol |
| IUPAC name | 6-amino-5-nitroso-3-(trideuteriomethyl)-1H-pyrimidine-2,4-dione |
| InChIKey | GUDXLMQIDACJSU-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C(=O)C(=C(NC1=O)N)N=O |
Computed by PubChem (NCBI)