Products 1246820-42-7
CAS 1246820-42-7 is the registry number for 6-Fluoro-3,4-dihydro-2-(2-oxiranyl)-2H-1-benzopyran-d2 (Mixture of Diastereomers). Offered by: TRC. Available pack sizes: 100mg, 10mg.
2-(3,3-dideuteriooxiran-2-yl)-6-fluoro-3,4-dihydro-2H-chromene (CAS 1246820-42-7) is a chemical compound with the molecular formula C11H11FO2 and a molecular weight of 196.21 g/mol. IUPAC name: 2-(3,3-dideuteriooxiran-2-yl)-6-fluoro-3,4-dihydro-2H-chromene. InChIKey: GVZDIJGBXSDSEP-NCYHJHSESA-N.
| Molecular formula | C11H11FO2 |
|---|---|
| Molecular weight | 196.21 g/mol |
| IUPAC name | 2-(3,3-dideuteriooxiran-2-yl)-6-fluoro-3,4-dihydro-2H-chromene |
| InChIKey | GVZDIJGBXSDSEP-NCYHJHSESA-N |
| SMILES | [2H]C1(C(O1)C2CCC3=C(O2)C=CC(=C3)F)[2H] |
Computed by PubChem (NCBI)